C16H26O — CID 66059935
5,5-dimethyl-2-[(2-methylphenyl)methyl]hexan-1-ol (PubChem CID 66059935) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(2-methylphenyl)methyl]hexan-1-ol.
| Compound Name | 5,5-dimethyl-2-[(2-methylphenyl)methyl]hexan-1-ol |
|---|---|
| PubChem CID | 66059935 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 5,5-dimethyl-2-[(2-methylphenyl)methyl]hexan-1-ol |
| SMILES | Cc1ccccc1CC(CO)CCC(C)(C)C |
| InChI | InChI=1S/C16H26O/c1-13-7-5-6-8-15(13)11-14(12-17)9-10-16(2,3)4/h5-8,14,17H,9-12H2,1-4H3 |
| InChIKey | UDMRAWXQOBQRBS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |