C15H22Cl2 — CID 66050569
1-chloro-2-[2-(chloromethyl)-5,5-dimethylhexyl]benzene (PubChem CID 66050569) has the molecular formula C15H22Cl2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 1-chloro-2-[2-(chloromethyl)-5,5-dimethylhexyl]benzene.
| Compound Name | 1-chloro-2-[2-(chloromethyl)-5,5-dimethylhexyl]benzene |
|---|---|
| PubChem CID | 66050569 |
| Molecular Formula | C15H22Cl2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-chloro-2-[2-(chloromethyl)-5,5-dimethylhexyl]benzene |
| SMILES | CC(C)(C)CCC(CCl)Cc1ccccc1Cl |
| InChI | InChI=1S/C15H22Cl2/c1-15(2,3)9-8-12(11-16)10-13-6-4-5-7-14(13)17/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | KUEHLIMTLZUUGQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|