C16H23F3O2 — CID 66060409
2-ethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]hexan-1-ol (PubChem CID 66060409) has the molecular formula C16H23F3O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-ethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]hexan-1-ol.
| Compound Name | 2-ethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 66060409 |
| Molecular Formula | C16H23F3O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-ethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]hexan-1-ol |
| SMILES | CCCCC(CC)(CO)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H23F3O2/c1-3-5-10-15(4-2,12-20)11-13-6-8-14(9-7-13)21-16(17,18)19/h6-9,20H,3-5,10-12H2,1-2H3 |
| InChIKey | PAGHRMVRNWPYAP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |