C11H17N5O2 — CID 66061316
4-(4-amino-1-ethyl-3-methylpyrazol-5-yl)-3-methylpiperazine-2,6-dione (PubChem CID 66061316) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-(4-amino-1-ethyl-3-methylpyrazol-5-yl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-amino-1-ethyl-3-methylpyrazol-5-yl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66061316 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 4-(4-amino-1-ethyl-3-methylpyrazol-5-yl)-3-methylpiperazine-2,6-dione |
| SMILES | CCn1nc(C)c(N)c1N1CC(=O)NC(=O)C1C |
| InChI | InChI=1S/C11H17N5O2/c1-4-16-11(9(12)6(2)14-16)15-5-8(17)13-10(18)7(15)3/h7H,4-5,12H2,1-3H3,(H,13,17,18) |
| InChIKey | XGHUWZHDKZCHGJ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|