C12H19N5O2 — CID 66062479
4-(4-amino-3-methyl-1-propylpyrazol-5-yl)-3-methylpiperazine-2,6-dione (PubChem CID 66062479) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 4-(4-amino-3-methyl-1-propylpyrazol-5-yl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-amino-3-methyl-1-propylpyrazol-5-yl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66062479 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-(4-amino-3-methyl-1-propylpyrazol-5-yl)-3-methylpiperazine-2,6-dione |
| SMILES | CCCn1nc(C)c(N)c1N1CC(=O)NC(=O)C1C |
| InChI | InChI=1S/C12H19N5O2/c1-4-5-17-12(10(13)7(2)15-17)16-6-9(18)14-11(19)8(16)3/h8H,4-6,13H2,1-3H3,(H,14,18,19) |
| InChIKey | IRADYFHGQJOCSU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|