C12H10ClN3O4S — CID 66061801
4-chloro-2-(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylbenzonitrile (PubChem CID 66061801) has the molecular formula C12H10ClN3O4S and a molecular weight of 327.75 g/mol. Its IUPAC name is 4-chloro-2-(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylbenzonitrile.
| Compound Name | 4-chloro-2-(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 66061801 |
| Molecular Formula | C12H10ClN3O4S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 4-chloro-2-(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylbenzonitrile |
| SMILES | CC1C(=O)NC(=O)CN1S(=O)(=O)c1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C12H10ClN3O4S/c1-7-12(18)15-11(17)6-16(7)21(19,20)10-4-9(13)3-2-8(10)5-14/h2-4,7H,6H2,1H3,(H,15,17,18) |
| InChIKey | BCRXPARMCSHYGS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|