C11H10ClFN2O4S — CID 66063341
4-(4-chloro-2-fluorophenyl)sulfonyl-3-methylpiperazine-2,6-dione (PubChem CID 66063341) has the molecular formula C11H10ClFN2O4S and a molecular weight of 320.73 g/mol. Its IUPAC name is 4-(4-chloro-2-fluorophenyl)sulfonyl-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-chloro-2-fluorophenyl)sulfonyl-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66063341 |
| Molecular Formula | C11H10ClFN2O4S |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 4-(4-chloro-2-fluorophenyl)sulfonyl-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1S(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H10ClFN2O4S/c1-6-11(17)14-10(16)5-15(6)20(18,19)9-3-2-7(12)4-8(9)13/h2-4,6H,5H2,1H3,(H,14,16,17) |
| InChIKey | HNIMEDIFYARMLC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|