C12H17N5O3 — CID 66062261
4-(4-amino-5-propan-2-yl-1H-pyrazole-3-carbonyl)-3-methylpiperazine-2,6-dione (PubChem CID 66062261) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-(4-amino-5-propan-2-yl-1H-pyrazole-3-carbonyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-amino-5-propan-2-yl-1H-pyrazole-3-carbonyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66062261 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-(4-amino-5-propan-2-yl-1H-pyrazole-3-carbonyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC(C)c1[nH]nc(C(=O)N2CC(=O)NC(=O)C2C)c1N |
| InChI | InChI=1S/C12H17N5O3/c1-5(2)9-8(13)10(16-15-9)12(20)17-4-7(18)14-11(19)6(17)3/h5-6H,4,13H2,1-3H3,(H,15,16)(H,14,18,19) |
| InChIKey | RWKFAACIRUDDHU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|