C8H9N5O4 — CID 66061604
4-(4-amino-1,2,5-oxadiazole-3-carbonyl)-3-methylpiperazine-2,6-dione (PubChem CID 66061604) has the molecular formula C8H9N5O4 and a molecular weight of 239.19 g/mol. Its IUPAC name is 4-(4-amino-1,2,5-oxadiazole-3-carbonyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-amino-1,2,5-oxadiazole-3-carbonyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66061604 |
| Molecular Formula | C8H9N5O4 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-(4-amino-1,2,5-oxadiazole-3-carbonyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)c1nonc1N |
| InChI | InChI=1S/C8H9N5O4/c1-3-7(15)10-4(14)2-13(3)8(16)5-6(9)12-17-11-5/h3H,2H2,1H3,(H2,9,12)(H,10,14,15) |
| InChIKey | WBAPUCVIAUYOIO-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|