C11H19N3O3 — CID 66067507
2-(3,3-dimethyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide (PubChem CID 66067507) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(3,3-dimethyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 66067507 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-(3,3-dimethyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1C(=O)CNC(C)(C)C1=O |
| InChI | InChI=1S/C11H19N3O3/c1-7(2)13-8(15)6-14-9(16)5-12-11(3,4)10(14)17/h7,12H,5-6H2,1-4H3,(H,13,15) |
| InChIKey | QHLLPNDNYJWTLS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|