C12H16N4O3S — CID 66075529
3,3-dimethyl-4-(4-propylthiadiazole-5-carbonyl)piperazine-2,6-dione (PubChem CID 66075529) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3,3-dimethyl-4-(4-propylthiadiazole-5-carbonyl)piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-(4-propylthiadiazole-5-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66075529 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3,3-dimethyl-4-(4-propylthiadiazole-5-carbonyl)piperazine-2,6-dione |
| SMILES | CCCc1nnsc1C(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C12H16N4O3S/c1-4-5-7-9(20-15-14-7)10(18)16-6-8(17)13-11(19)12(16,2)3/h4-6H2,1-3H3,(H,13,17,19) |
| InChIKey | UXWBMGOUSHDBEZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|