C11H11N3O5S — CID 116697246
2-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 116697246) has the molecular formula C11H11N3O5S and a molecular weight of 297.29 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116697246 |
| Molecular Formula | C11H11N3O5S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H11N3O5S/c1-11(2)10(19)13-6(15)3-14(11)8(16)7-12-5(4-20-7)9(17)18/h4H,3H2,1-2H3,(H,17,18)(H,13,15,19) |
| InChIKey | QBDMSAFXOJHWQZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|