C12H15N3O4S — CID 103487968
3-[2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103487968) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 3-[2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103487968 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-[2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1c1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C12H15N3O4S/c1-12(2)10(19)14-8(16)5-15(12)11-13-7(6-20-11)3-4-9(17)18/h6H,3-5H2,1-2H3,(H,17,18)(H,14,16,19) |
| InChIKey | XMKYUBAFCPUDGC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|