C15H20IN3O2 — CID 66082499
1-(4-iodo-2-nitrophenyl)-1,4-diazaspiro[5.5]undecane (PubChem CID 66082499) has the molecular formula C15H20IN3O2 and a molecular weight of 401.25 g/mol. Its IUPAC name is 1-(4-iodo-2-nitrophenyl)-1,4-diazaspiro[5.5]undecane.
| Compound Name | 1-(4-iodo-2-nitrophenyl)-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 66082499 |
| Molecular Formula | C15H20IN3O2 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 1-(4-iodo-2-nitrophenyl)-1,4-diazaspiro[5.5]undecane |
| SMILES | O=[N+]([O-])c1cc(I)ccc1N1CCNCC12CCCCC2 |
| InChI | InChI=1S/C15H20IN3O2/c16-12-4-5-13(14(10-12)19(20)21)18-9-8-17-11-15(18)6-2-1-3-7-15/h4-5,10,17H,1-3,6-9,11H2 |
| InChIKey | ICSIULAEQOKMNB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|