C45H47N3O7 — CID 6608826
9H-fluoren-9-ylmethyl N-[(3S,6R,12S)-3-benzyl-6-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-12-yl]carbamate (PubChem CID 6608826) has the molecular formula C45H47N3O7 and a molecular weight of 741.89 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(3S,6R,12S)-3-benzyl-6-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-12-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(3S,6R,12S)-3-benzyl-6-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-12-yl]carbamate |
|---|---|
| PubChem CID | 6608826 |
| Molecular Formula | C45H47N3O7 |
| Molecular Weight | 741.89 g/mol |
| Exact Mass | 741.34 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(3S,6R,12S)-3-benzyl-6-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-12-yl]carbamate |
| SMILES | O=C(N[C@H]1CCC=CC[C@H](CC(=O)N2Cc3ccccc3C[C@H]2CO)C(=O)N[C@@H](Cc2ccccc2)COC1=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C45H47N3O7/c49-27-35-24-31-15-7-8-17-33(31)26-48(35)42(50)25-32-16-5-2-6-22-41(44(52)54-28-34(46-43(32)51)23-30-13-3-1-4-14-30)47-45(53)55-29-40-38-20-11-9-18-36(38)37-19-10-12-21-39(37)40/h1-5,7-15,17-21,32,34-35,40-41,49H,6,16,22-29H2,(H,46,51)(H,47,53)/t32-,34+,35+,41+/m1/s1 |
| InChIKey | DZRXFGONMYMPCI-KXTMUHNYSA-N |
| XLogP | 5.86 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.89 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|