C36H40N2O5 — CID 6609170
(3R,6R,12R)-12-benzyl-6-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-phenyl-1-oxa-4-azacyclotridec-8-ene-5,13-dione (PubChem CID 6609170) has the molecular formula C36H40N2O5 and a molecular weight of 580.73 g/mol. Its IUPAC name is (3R,6R,12R)-12-benzyl-6-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-phenyl-1-oxa-4-azacyclotridec-8-ene-5,13-dione.
| Compound Name | (3R,6R,12R)-12-benzyl-6-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-phenyl-1-oxa-4-azacyclotridec-8-ene-5,13-dione |
|---|---|
| PubChem CID | 6609170 |
| Molecular Formula | C36H40N2O5 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | (3R,6R,12R)-12-benzyl-6-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-phenyl-1-oxa-4-azacyclotridec-8-ene-5,13-dione |
| SMILES | O=C1N[C@H](c2ccccc2)COC(=O)[C@@H](Cc2ccccc2)CCC=CC[C@@H]1CC(=O)N1Cc2ccccc2C[C@H]1CO |
| InChI | InChI=1S/C36H40N2O5/c39-24-32-21-28-16-10-11-19-31(28)23-38(32)34(40)22-29-17-8-3-9-18-30(20-26-12-4-1-5-13-26)36(42)43-25-33(37-35(29)41)27-14-6-2-7-15-27/h1-8,10-16,19,29-30,32-33,39H,9,17-18,20-25H2,(H,37,41)/t29-,30-,32+,33+/m1/s1 |
| InChIKey | POLBCAJGZFXALX-AOBJZNIWSA-N |
| XLogP | 4.94 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|