C45H47N3O9 — CID 6608811
benzyl (3R,6R,12S)-6-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-12-(9H-fluoren-9-ylmethoxycarbonylamino)-5,13-dioxo-1-oxa-4-azacyclotridec-8-ene-3-carboxylate (PubChem CID 6608811) has the molecular formula C45H47N3O9 and a molecular weight of 773.88 g/mol. Its IUPAC name is benzyl (3R,6R,12S)-6-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-12-(9H-fluoren-9-ylmethoxycarbonylamino)-5,13-dioxo-1-oxa-4-azacyclotridec-8-ene-3-carboxylate.
| Compound Name | benzyl (3R,6R,12S)-6-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-12-(9H-fluoren-9-ylmethoxycarbonylamino)-5,13-dioxo-1-oxa-4-azacyclotridec-8-ene-3-carboxylate |
|---|---|
| PubChem CID | 6608811 |
| Molecular Formula | C45H47N3O9 |
| Molecular Weight | 773.88 g/mol |
| Exact Mass | 773.33 |
| IUPAC Name | benzyl (3R,6R,12S)-6-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-12-(9H-fluoren-9-ylmethoxycarbonylamino)-5,13-dioxo-1-oxa-4-azacyclotridec-8-ene-3-carboxylate |
| SMILES | O=C(N[C@H]1CCC=CC[C@H](CC(=O)N(CCO)Cc2ccccc2)C(=O)N[C@@H](C(=O)OCc2ccccc2)COC1=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C45H47N3O9/c49-25-24-48(27-31-14-4-1-5-15-31)41(50)26-33-18-8-3-9-23-39(43(52)56-30-40(46-42(33)51)44(53)55-28-32-16-6-2-7-17-32)47-45(54)57-29-38-36-21-12-10-19-34(36)35-20-11-13-22-37(35)38/h1-8,10-17,19-22,33,38-40,49H,9,18,23-30H2,(H,46,51)(H,47,54)/t33-,39+,40-/m1/s1 |
| InChIKey | YXGNFEMYBZOAJC-FOMDDGNBSA-N |
| XLogP | 5.43 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.88 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|