C32H39N3O8 — CID 6608900
9H-fluoren-9-ylmethyl N-[(6R,12S)-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-12-yl]carbamate (PubChem CID 6608900) has the molecular formula C32H39N3O8 and a molecular weight of 593.68 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(6R,12S)-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-12-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(6R,12S)-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-12-yl]carbamate |
|---|---|
| PubChem CID | 6608900 |
| Molecular Formula | C32H39N3O8 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(6R,12S)-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-12-yl]carbamate |
| SMILES | O=C(C[C@H]1CC=CCC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OCCNC1=O)NCCOCCO |
| InChI | InChI=1S/C32H39N3O8/c36-16-19-41-17-14-33-29(37)20-22-8-2-1-3-13-28(31(39)42-18-15-34-30(22)38)35-32(40)43-21-27-25-11-6-4-9-23(25)24-10-5-7-12-26(24)27/h1-2,4-7,9-12,22,27-28,36H,3,8,13-21H2,(H,33,37)(H,34,38)(H,35,40)/t22-,28+/m1/s1 |
| InChIKey | FNOCUJANDKWCHA-DFHRPNOPSA-N |
| XLogP | 2.42 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|