C10H17ClN4O2 — CID 66091802
N-(4-chloro-2-methylbutyl)-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 66091802) has the molecular formula C10H17ClN4O2 and a molecular weight of 260.72 g/mol. Its IUPAC name is N-(4-chloro-2-methylbutyl)-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(4-chloro-2-methylbutyl)-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 66091802 |
| Molecular Formula | C10H17ClN4O2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-(4-chloro-2-methylbutyl)-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NCC(C)CCCl)nc(OC)n1 |
| InChI | InChI=1S/C10H17ClN4O2/c1-7(4-5-11)6-12-8-13-9(16-2)15-10(14-8)17-3/h7H,4-6H2,1-3H3,(H,12,13,14,15) |
| InChIKey | OYVCJGRJBYNDSA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|