methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate

C9H17NO4S — CID 66098962

IUPACmethyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate
SMILESCOC(=O)CC1(C(C)N)CCS(=O)(=O)C1
InChIInChI=1S/C9H17NO4S/c1-7(10)9(5-8(11)14-2)3-4-15(12,13)6-9/h7H,3-6,10H2,1-2H3
InChIKeyMHJRQTNZLREHET-UHFFFAOYSA-N
MW235.30 g/mol
LogP-0.30
Rot. Bonds3

About methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate

methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 66098962) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate
PubChem CID66098962
Molecular FormulaC9H17NO4S
Molecular Weight235.30 g/mol
Exact Mass235.09
IUPAC Namemethyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate
SMILESCOC(=O)CC1(C(C)N)CCS(=O)(=O)C1
InChIInChI=1S/C9H17NO4S/c1-7(10)9(5-8(11)14-2)3-4-15(12,13)6-9/h7H,3-6,10H2,1-2H3
InChIKeyMHJRQTNZLREHET-UHFFFAOYSA-N
XLogP-0.30
TPSA86.46 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.30
LogP ≤ 5-0.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate?
The IUPAC name of methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate (CID 66098962) is methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate.
What is the SMILES notation for methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate?
The canonical SMILES for methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate is COC(=O)CC1(C(C)N)CCS(=O)(=O)C1.
What is the InChIKey of methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate?
The InChIKey is MHJRQTNZLREHET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4S/c1-7(10)9(5-8(11)14-2)3-4-15(12,13)6-9/h7H,3-6,10H2,1-2H3.
What are the key properties of methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate?
methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate has a molecular weight of 235.30 g/mol, XLogP of -0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetate is sourced from PubChem (CID 66098962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).