C14H14FIN2O2S — CID 66100974
2-[1-(cyclobutylmethyl)-6-fluoro-5-iodobenzimidazol-2-yl]sulfanylacetic acid (PubChem CID 66100974) has the molecular formula C14H14FIN2O2S and a molecular weight of 420.25 g/mol. Its IUPAC name is 2-[1-(cyclobutylmethyl)-6-fluoro-5-iodobenzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(cyclobutylmethyl)-6-fluoro-5-iodobenzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 66100974 |
| Molecular Formula | C14H14FIN2O2S |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | 2-[1-(cyclobutylmethyl)-6-fluoro-5-iodobenzimidazol-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc2cc(I)c(F)cc2n1CC1CCC1 |
| InChI | InChI=1S/C14H14FIN2O2S/c15-9-4-12-11(5-10(9)16)17-14(21-7-13(19)20)18(12)6-8-2-1-3-8/h4-5,8H,1-3,6-7H2,(H,19,20) |
| InChIKey | FGSNPYIBYJOJGR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|