C15H13FIN3O — CID 66101378
6-fluoro-5-iodo-1-[(3-methoxyphenyl)methyl]benzimidazol-2-amine (PubChem CID 66101378) has the molecular formula C15H13FIN3O and a molecular weight of 397.19 g/mol. Its IUPAC name is 6-fluoro-5-iodo-1-[(3-methoxyphenyl)methyl]benzimidazol-2-amine.
| Compound Name | 6-fluoro-5-iodo-1-[(3-methoxyphenyl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 66101378 |
| Molecular Formula | C15H13FIN3O |
| Molecular Weight | 397.19 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 6-fluoro-5-iodo-1-[(3-methoxyphenyl)methyl]benzimidazol-2-amine |
| SMILES | COc1cccc(Cn2c(N)nc3cc(I)c(F)cc32)c1 |
| InChI | InChI=1S/C15H13FIN3O/c1-21-10-4-2-3-9(5-10)8-20-14-6-11(16)12(17)7-13(14)19-15(20)18/h2-7H,8H2,1H3,(H2,18,19) |
| InChIKey | WPSSDTRHPKTNJS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|