C13H19NOS — CID 66106979
5,5-dimethyl-4-propan-2-yl-4-thiophen-2-ylpyrrolidin-2-one (PubChem CID 66106979) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 5,5-dimethyl-4-propan-2-yl-4-thiophen-2-ylpyrrolidin-2-one.
| Compound Name | 5,5-dimethyl-4-propan-2-yl-4-thiophen-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 66106979 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 5,5-dimethyl-4-propan-2-yl-4-thiophen-2-ylpyrrolidin-2-one |
| SMILES | CC(C)C1(c2cccs2)CC(=O)NC1(C)C |
| InChI | InChI=1S/C13H19NOS/c1-9(2)13(10-6-5-7-16-10)8-11(15)14-12(13,3)4/h5-7,9H,8H2,1-4H3,(H,14,15) |
| InChIKey | QCTAVAMTSPNBME-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |