C11H10N2O4S — CID 661101
2-(N-(2,4-dioxo-1,3-thiazolidin-5-yl)anilino)acetic acid (PubChem CID 661101) has the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-(N-(2,4-dioxo-1,3-thiazolidin-5-yl)anilino)acetic acid.
| Compound Name | 2-(N-(2,4-dioxo-1,3-thiazolidin-5-yl)anilino)acetic acid |
|---|---|
| PubChem CID | 661101 |
| Molecular Formula | C11H10N2O4S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2-(N-(2,4-dioxo-1,3-thiazolidin-5-yl)anilino)acetic acid |
| SMILES | O=C(O)CN(c1ccccc1)C1SC(=O)NC1=O |
| InChI | InChI=1S/C11H10N2O4S/c14-8(15)6-13(7-4-2-1-3-5-7)10-9(16)12-11(17)18-10/h1-5,10H,6H2,(H,14,15)(H,12,16,17) |
| InChIKey | UKTWOSAHVBWMEA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|