C9H16N2O2S — CID 66114960
3-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methylsulfanyl]propan-1-ol (PubChem CID 66114960) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 3-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methylsulfanyl]propan-1-ol.
| Compound Name | 3-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 66114960 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methylsulfanyl]propan-1-ol |
| SMILES | CC(C)c1noc(CSCCCO)n1 |
| InChI | InChI=1S/C9H16N2O2S/c1-7(2)9-10-8(13-11-9)6-14-5-3-4-12/h7,12H,3-6H2,1-2H3 |
| InChIKey | ILPVFPLNTSOAFO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|