C14H15BrFN3O2 — CID 66119517
(4-bromo-2-fluorophenyl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate (PubChem CID 66119517) has the molecular formula C14H15BrFN3O2 and a molecular weight of 356.20 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate.
| Compound Name | (4-bromo-2-fluorophenyl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 66119517 |
| Molecular Formula | C14H15BrFN3O2 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate |
| SMILES | CCc1nn(C)c(C(=O)OCc2ccc(Br)cc2F)c1N |
| InChI | InChI=1S/C14H15BrFN3O2/c1-3-11-12(17)13(19(2)18-11)14(20)21-7-8-4-5-9(15)6-10(8)16/h4-6H,3,7,17H2,1-2H3 |
| InChIKey | OGTZRZIZAWCRBS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |