About (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate
(2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate (PubChem CID 66118684) has the molecular formula C12H16N4O2S
and a molecular weight of 280.35 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate |
| PubChem CID | 66118684 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate |
| SMILES | CCc1nn(C)c(C(=O)OCc2csc(C)n2)c1N |
| InChI | InChI=1S/C12H16N4O2S/c1-4-9-10(13)11(16(3)15-9)12(17)18-5-8-6-19-7(2)14-8/h6H,4-5,13H2,1-3H3 |
| InChIKey | PJSXTICYBHUKTO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
The IUPAC name of (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate (CID 66118684) is (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate.
What is the SMILES notation for (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
The canonical SMILES for (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate is CCc1nn(C)c(C(=O)OCc2csc(C)n2)c1N.
What is the InChIKey of (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
The InChIKey is PJSXTICYBHUKTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S/c1-4-9-10(13)11(16(3)15-9)12(17)18-5-8-6-19-7(2)14-8/h6H,4-5,13H2,1-3H3.
What are the key properties of (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
(2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate has a molecular weight of 280.35 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate is sourced from PubChem (CID 66118684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).