2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate

C8H11F2N3O2 — CID 66125010

IUPAC2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate
SMILESCc1nn(C)c(C(=O)OCC(F)F)c1N
InChIInChI=1S/C8H11F2N3O2/c1-4-6(11)7(13(2)12-4)8(14)15-3-5(9)10/h5H,3,11H2,1-2H3
InChIKeyLNHMVKRFRZUVLB-UHFFFAOYSA-N
MW219.19 g/mol
LogP0.73
Rot. Bonds3

About 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate

2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 66125010) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate.

Molecular Properties

Compound Name2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate
PubChem CID66125010
Molecular FormulaC8H11F2N3O2
Molecular Weight219.19 g/mol
Exact Mass219.08
IUPAC Name2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate
SMILESCc1nn(C)c(C(=O)OCC(F)F)c1N
InChIInChI=1S/C8H11F2N3O2/c1-4-6(11)7(13(2)12-4)8(14)15-3-5(9)10/h5H,3,11H2,1-2H3
InChIKeyLNHMVKRFRZUVLB-UHFFFAOYSA-N
XLogP0.73
TPSA70.14 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.19
LogP ≤ 50.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The IUPAC name of 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate (CID 66125010) is 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate.
What is the SMILES notation for 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The canonical SMILES for 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate is Cc1nn(C)c(C(=O)OCC(F)F)c1N.
What is the InChIKey of 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The InChIKey is LNHMVKRFRZUVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3O2/c1-4-6(11)7(13(2)12-4)8(14)15-3-5(9)10/h5H,3,11H2,1-2H3.
What are the key properties of 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate?
2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate has a molecular weight of 219.19 g/mol, XLogP of 0.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethyl 4-amino-1,3-dimethylpyrazole-5-carboxylate is sourced from PubChem (CID 66125010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).