About (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate
(3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 66124416) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate |
| PubChem CID | 66124416 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate |
| SMILES | Cc1nn(C)c(C(=O)OC2CC(C)CC(C)C2)c1N |
| InChI | InChI=1S/C14H23N3O2/c1-8-5-9(2)7-11(6-8)19-14(18)13-12(15)10(3)16-17(13)4/h8-9,11H,5-7,15H2,1-4H3 |
| InChIKey | GXBLQXICEUHZLT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The IUPAC name of (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate (CID 66124416) is (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate.
What is the SMILES notation for (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The canonical SMILES for (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate is Cc1nn(C)c(C(=O)OC2CC(C)CC(C)C2)c1N.
What is the InChIKey of (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate?
The InChIKey is GXBLQXICEUHZLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-8-5-9(2)7-11(6-8)19-14(18)13-12(15)10(3)16-17(13)4/h8-9,11H,5-7,15H2,1-4H3.
What are the key properties of (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate?
(3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate has a molecular weight of 265.36 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylcyclohexyl) 4-amino-1,3-dimethylpyrazole-5-carboxylate is sourced from PubChem (CID 66124416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).