About 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate
3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate (PubChem CID 81114507) has the molecular formula C10H16FN3O2
and a molecular weight of 229.25 g/mol. Its IUPAC name is 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate |
| PubChem CID | 81114507 |
| Molecular Formula | C10H16FN3O2 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate |
| SMILES | CCc1nn(C)c(C(=O)OCCCF)c1N |
| InChI | InChI=1S/C10H16FN3O2/c1-3-7-8(12)9(14(2)13-7)10(15)16-6-4-5-11/h3-6,12H2,1-2H3 |
| InChIKey | ZNMQDLPJGSQYEX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
The IUPAC name of 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate (CID 81114507) is 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate.
What is the SMILES notation for 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
The canonical SMILES for 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate is CCc1nn(C)c(C(=O)OCCCF)c1N.
What is the InChIKey of 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
The InChIKey is ZNMQDLPJGSQYEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16FN3O2/c1-3-7-8(12)9(14(2)13-7)10(15)16-6-4-5-11/h3-6,12H2,1-2H3.
What are the key properties of 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate?
3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate has a molecular weight of 229.25 g/mol, XLogP of 1.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropropyl 4-amino-3-ethyl-1-methylpyrazole-5-carboxylate is sourced from PubChem (CID 81114507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).