About oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate
oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate (PubChem CID 66125269) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate |
| PubChem CID | 66125269 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate |
| SMILES | CCn1nc(C)c(N)c1C(=O)OC1CCOCC1 |
| InChI | InChI=1S/C12H19N3O3/c1-3-15-11(10(13)8(2)14-15)12(16)18-9-4-6-17-7-5-9/h9H,3-7,13H2,1-2H3 |
| InChIKey | BBWXWVMAUXWAMZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate?
The IUPAC name of oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate (CID 66125269) is oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate.
What is the SMILES notation for oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate?
The canonical SMILES for oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate is CCn1nc(C)c(N)c1C(=O)OC1CCOCC1.
What is the InChIKey of oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate?
The InChIKey is BBWXWVMAUXWAMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-3-15-11(10(13)8(2)14-15)12(16)18-9-4-6-17-7-5-9/h9H,3-7,13H2,1-2H3.
What are the key properties of oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate?
oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate has a molecular weight of 253.30 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate is sourced from PubChem (CID 66125269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).