C11H18N4O3 — CID 66125280
(1-amino-1-oxobutan-2-yl) 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate (PubChem CID 66125280) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (1-amino-1-oxobutan-2-yl) 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate.
| Compound Name | (1-amino-1-oxobutan-2-yl) 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 66125280 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (1-amino-1-oxobutan-2-yl) 4-amino-1-ethyl-3-methylpyrazole-5-carboxylate |
| SMILES | CCC(OC(=O)c1c(N)c(C)nn1CC)C(N)=O |
| InChI | InChI=1S/C11H18N4O3/c1-4-7(10(13)16)18-11(17)9-8(12)6(3)14-15(9)5-2/h7H,4-5,12H2,1-3H3,(H2,13,16) |
| InChIKey | ZSAOIUZELJKNDH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |