C12H22N4O — CID 66134960
2-(1,4-diazepan-1-yl)-2-(3-ethylimidazol-4-yl)ethanol (PubChem CID 66134960) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(3-ethylimidazol-4-yl)ethanol.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(3-ethylimidazol-4-yl)ethanol |
|---|---|
| PubChem CID | 66134960 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(3-ethylimidazol-4-yl)ethanol |
| SMILES | CCn1cncc1C(CO)N1CCCNCC1 |
| InChI | InChI=1S/C12H22N4O/c1-2-15-10-14-8-11(15)12(9-17)16-6-3-4-13-5-7-16/h8,10,12-13,17H,2-7,9H2,1H3 |
| InChIKey | AJPXAQGFKPDNAA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |