C17H22BrNS2 — CID 66145067
1-(2-bromophenyl)sulfanyl-N-propyl-4-thiophen-3-ylbutan-2-amine (PubChem CID 66145067) has the molecular formula C17H22BrNS2 and a molecular weight of 384.41 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfanyl-N-propyl-4-thiophen-3-ylbutan-2-amine.
| Compound Name | 1-(2-bromophenyl)sulfanyl-N-propyl-4-thiophen-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 66145067 |
| Molecular Formula | C17H22BrNS2 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 1-(2-bromophenyl)sulfanyl-N-propyl-4-thiophen-3-ylbutan-2-amine |
| SMILES | CCCNC(CCc1ccsc1)CSc1ccccc1Br |
| InChI | InChI=1S/C17H22BrNS2/c1-2-10-19-15(8-7-14-9-11-20-12-14)13-21-17-6-4-3-5-16(17)18/h3-6,9,11-12,15,19H,2,7-8,10,13H2,1H3 |
| InChIKey | JWJYIRPTYVQDDK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |