C14H22BrNO2S2 — CID 66143702
1-(2-bromophenyl)sulfanyl-4-methylsulfonyl-N-propylbutan-2-amine (PubChem CID 66143702) has the molecular formula C14H22BrNO2S2 and a molecular weight of 380.37 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfanyl-4-methylsulfonyl-N-propylbutan-2-amine.
| Compound Name | 1-(2-bromophenyl)sulfanyl-4-methylsulfonyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 66143702 |
| Molecular Formula | C14H22BrNO2S2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 1-(2-bromophenyl)sulfanyl-4-methylsulfonyl-N-propylbutan-2-amine |
| SMILES | CCCNC(CCS(C)(=O)=O)CSc1ccccc1Br |
| InChI | InChI=1S/C14H22BrNO2S2/c1-3-9-16-12(8-10-20(2,17)18)11-19-14-7-5-4-6-13(14)15/h4-7,12,16H,3,8-11H2,1-2H3 |
| InChIKey | DQWHTNDBZCYEBU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |