C15H22BrNS — CID 66142536
1-(2-bromophenyl)sulfanyl-N-propylhex-5-en-2-amine (PubChem CID 66142536) has the molecular formula C15H22BrNS and a molecular weight of 328.32 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfanyl-N-propylhex-5-en-2-amine.
| Compound Name | 1-(2-bromophenyl)sulfanyl-N-propylhex-5-en-2-amine |
|---|---|
| PubChem CID | 66142536 |
| Molecular Formula | C15H22BrNS |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1-(2-bromophenyl)sulfanyl-N-propylhex-5-en-2-amine |
| SMILES | C=CCCC(CSc1ccccc1Br)NCCC |
| InChI | InChI=1S/C15H22BrNS/c1-3-5-8-13(17-11-4-2)12-18-15-10-7-6-9-14(15)16/h3,6-7,9-10,13,17H,1,4-5,8,11-12H2,2H3 |
| InChIKey | RJDQYBXFIYZUOP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|