C9H10N2OS2 — CID 66146780
4-(hydroxymethyl)-3-(thiophen-3-ylmethyl)-1H-imidazole-2-thione (PubChem CID 66146780) has the molecular formula C9H10N2OS2 and a molecular weight of 226.33 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-(thiophen-3-ylmethyl)-1H-imidazole-2-thione.
| Compound Name | 4-(hydroxymethyl)-3-(thiophen-3-ylmethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 66146780 |
| Molecular Formula | C9H10N2OS2 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 4-(hydroxymethyl)-3-(thiophen-3-ylmethyl)-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1Cc1ccsc1 |
| InChI | InChI=1S/C9H10N2OS2/c12-5-8-3-10-9(13)11(8)4-7-1-2-14-6-7/h1-3,6,12H,4-5H2,(H,10,13) |
| InChIKey | SIPRKSNQDRKBPC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|