C9H14N2O3S2 — CID 66147608
3-[(1,1-dioxothiolan-3-yl)methyl]-4-(hydroxymethyl)-1H-imidazole-2-thione (PubChem CID 66147608) has the molecular formula C9H14N2O3S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methyl]-4-(hydroxymethyl)-1H-imidazole-2-thione.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methyl]-4-(hydroxymethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 66147608 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methyl]-4-(hydroxymethyl)-1H-imidazole-2-thione |
| SMILES | O=S1(=O)CCC(Cn2c(CO)c[nH]c2=S)C1 |
| InChI | InChI=1S/C9H14N2O3S2/c12-5-8-3-10-9(15)11(8)4-7-1-2-16(13,14)6-7/h3,7,12H,1-2,4-6H2,(H,10,15) |
| InChIKey | CKUSJTCOBKPTJA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|