C12H20N2O — CID 66149976
[3-(2,3-dimethylcyclohexyl)imidazol-4-yl]methanol (PubChem CID 66149976) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is [3-(2,3-dimethylcyclohexyl)imidazol-4-yl]methanol.
| Compound Name | [3-(2,3-dimethylcyclohexyl)imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 66149976 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | [3-(2,3-dimethylcyclohexyl)imidazol-4-yl]methanol |
| SMILES | CC1CCCC(n2cncc2CO)C1C |
| InChI | InChI=1S/C12H20N2O/c1-9-4-3-5-12(10(9)2)14-8-13-6-11(14)7-15/h6,8-10,12,15H,3-5,7H2,1-2H3 |
| InChIKey | XYZVHFRVFRYRCS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |