C12H11Br2N3O3 — CID 66158095
N-(2-amino-4,6-dibromophenyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 66158095) has the molecular formula C12H11Br2N3O3 and a molecular weight of 405.05 g/mol. Its IUPAC name is N-(2-amino-4,6-dibromophenyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-amino-4,6-dibromophenyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 66158095 |
| Molecular Formula | C12H11Br2N3O3 |
| Molecular Weight | 405.05 g/mol |
| Exact Mass | 402.92 |
| IUPAC Name | N-(2-amino-4,6-dibromophenyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)Nc2c(N)cc(Br)cc2Br)no1 |
| InChI | InChI=1S/C12H11Br2N3O3/c1-19-5-7-4-10(17-20-7)12(18)16-11-8(14)2-6(13)3-9(11)15/h2-4H,5,15H2,1H3,(H,16,18) |
| InChIKey | NEDCQBJHXGAXJB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.05 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|