C17H20N2O5S2 — CID 6616573
N-(1,1,3,3-tetraoxo-1λ6,3λ6,2-benzodithiazol-2-yl)adamantane-1-carboxamide (PubChem CID 6616573) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-(1,1,3,3-tetraoxo-1λ6,3λ6,2-benzodithiazol-2-yl)adamantane-1-carboxamide.
| Compound Name | N-(1,1,3,3-tetraoxo-1λ6,3λ6,2-benzodithiazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 6616573 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-(1,1,3,3-tetraoxo-1λ6,3λ6,2-benzodithiazol-2-yl)adamantane-1-carboxamide |
| SMILES | O=C(NN1S(=O)(=O)c2ccccc2S1(=O)=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H20N2O5S2/c20-16(17-8-11-5-12(9-17)7-13(6-11)10-17)18-19-25(21,22)14-3-1-2-4-15(14)26(19,23)24/h1-4,11-13H,5-10H2,(H,18,20) |
| InChIKey | UODCCASZZYWVMO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |