C15H18N2O3 — CID 66170746
1-(2,3-dihydroxy-2-methylpropyl)-3-naphthalen-1-ylurea (PubChem CID 66170746) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(2,3-dihydroxy-2-methylpropyl)-3-naphthalen-1-ylurea.
| Compound Name | 1-(2,3-dihydroxy-2-methylpropyl)-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 66170746 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-(2,3-dihydroxy-2-methylpropyl)-3-naphthalen-1-ylurea |
| SMILES | CC(O)(CO)CNC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C15H18N2O3/c1-15(20,10-18)9-16-14(19)17-13-8-4-6-11-5-2-3-7-12(11)13/h2-8,18,20H,9-10H2,1H3,(H2,16,17,19) |
| InChIKey | CBEMSRIYUCHAKZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |