C14H20F2N2O2 — CID 66180643
5-amino-2,4-difluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzamide (PubChem CID 66180643) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzamide.
| Compound Name | 5-amino-2,4-difluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 66180643 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 5-amino-2,4-difluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzamide |
| SMILES | CC(C)CC(C)(O)CNC(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C14H20F2N2O2/c1-8(2)6-14(3,20)7-18-13(19)9-4-12(17)11(16)5-10(9)15/h4-5,8,20H,6-7,17H2,1-3H3,(H,18,19) |
| InChIKey | ISKRFBRXMXDIOJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|