C12H15F2N3O3 — CID 66196688
2-N-(2,3-difluoro-6-nitrophenyl)-3-ethoxycyclobutane-1,2-diamine (PubChem CID 66196688) has the molecular formula C12H15F2N3O3 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-N-(2,3-difluoro-6-nitrophenyl)-3-ethoxycyclobutane-1,2-diamine.
| Compound Name | 2-N-(2,3-difluoro-6-nitrophenyl)-3-ethoxycyclobutane-1,2-diamine |
|---|---|
| PubChem CID | 66196688 |
| Molecular Formula | C12H15F2N3O3 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-N-(2,3-difluoro-6-nitrophenyl)-3-ethoxycyclobutane-1,2-diamine |
| SMILES | CCOC1CC(N)C1Nc1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C12H15F2N3O3/c1-2-20-9-5-7(15)11(9)16-12-8(17(18)19)4-3-6(13)10(12)14/h3-4,7,9,11,16H,2,5,15H2,1H3 |
| InChIKey | KPUVJAILJBBSHK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|