C13H16N4O4 — CID 79883582
3-ethoxy-2-N-(4-nitro-1,3-benzoxazol-2-yl)cyclobutane-1,2-diamine (PubChem CID 79883582) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3-ethoxy-2-N-(4-nitro-1,3-benzoxazol-2-yl)cyclobutane-1,2-diamine.
| Compound Name | 3-ethoxy-2-N-(4-nitro-1,3-benzoxazol-2-yl)cyclobutane-1,2-diamine |
|---|---|
| PubChem CID | 79883582 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-ethoxy-2-N-(4-nitro-1,3-benzoxazol-2-yl)cyclobutane-1,2-diamine |
| SMILES | CCOC1CC(N)C1Nc1nc2c([N+](=O)[O-])cccc2o1 |
| InChI | InChI=1S/C13H16N4O4/c1-2-20-10-6-7(14)11(10)15-13-16-12-8(17(18)19)4-3-5-9(12)21-13/h3-5,7,10-11H,2,6,14H2,1H3,(H,15,16) |
| InChIKey | ZMTKMJCPXMCQGE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|