C14H19N3O3S — CID 66197446
N-(2-amino-4-ethoxycyclobutyl)-1-(4-cyanophenyl)methanesulfonamide (PubChem CID 66197446) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(2-amino-4-ethoxycyclobutyl)-1-(4-cyanophenyl)methanesulfonamide.
| Compound Name | N-(2-amino-4-ethoxycyclobutyl)-1-(4-cyanophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 66197446 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-(2-amino-4-ethoxycyclobutyl)-1-(4-cyanophenyl)methanesulfonamide |
| SMILES | CCOC1CC(N)C1NS(=O)(=O)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H19N3O3S/c1-2-20-13-7-12(16)14(13)17-21(18,19)9-11-5-3-10(8-15)4-6-11/h3-6,12-14,17H,2,7,9,16H2,1H3 |
| InChIKey | YMLIINYLXXFORQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |