C13H19FN2O4S — CID 66197056
N-(2-amino-4-ethoxycyclobutyl)-3-fluoro-4-methoxybenzenesulfonamide (PubChem CID 66197056) has the molecular formula C13H19FN2O4S and a molecular weight of 318.37 g/mol. Its IUPAC name is N-(2-amino-4-ethoxycyclobutyl)-3-fluoro-4-methoxybenzenesulfonamide.
| Compound Name | N-(2-amino-4-ethoxycyclobutyl)-3-fluoro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 66197056 |
| Molecular Formula | C13H19FN2O4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-(2-amino-4-ethoxycyclobutyl)-3-fluoro-4-methoxybenzenesulfonamide |
| SMILES | CCOC1CC(N)C1NS(=O)(=O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C13H19FN2O4S/c1-3-20-12-7-10(15)13(12)16-21(17,18)8-4-5-11(19-2)9(14)6-8/h4-6,10,12-13,16H,3,7,15H2,1-2H3 |
| InChIKey | MFNASKVJVPVTHD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |