C16H21ClN2O — CID 66200299
4-(3-chlorophenyl)-5-heptan-3-yl-1,2-oxazol-3-amine (PubChem CID 66200299) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-heptan-3-yl-1,2-oxazol-3-amine.
| Compound Name | 4-(3-chlorophenyl)-5-heptan-3-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200299 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-(3-chlorophenyl)-5-heptan-3-yl-1,2-oxazol-3-amine |
| SMILES | CCCCC(CC)c1onc(N)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2O/c1-3-5-7-11(4-2)15-14(16(18)19-20-15)12-8-6-9-13(17)10-12/h6,8-11H,3-5,7H2,1-2H3,(H2,18,19) |
| InChIKey | PZUCTYSWKCQBGK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |