C13H16N2O4S — CID 66200647
4-(4-ethoxyphenyl)-5-(methylsulfonylmethyl)-1,2-oxazol-3-amine (PubChem CID 66200647) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-5-(methylsulfonylmethyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(4-ethoxyphenyl)-5-(methylsulfonylmethyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200647 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-(4-ethoxyphenyl)-5-(methylsulfonylmethyl)-1,2-oxazol-3-amine |
| SMILES | CCOc1ccc(-c2c(N)noc2CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H16N2O4S/c1-3-18-10-6-4-9(5-7-10)12-11(8-20(2,16)17)19-15-13(12)14/h4-7H,3,8H2,1-2H3,(H2,14,15) |
| InChIKey | JYWMOLKOHCCDQW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |