C16H22N2O2 — CID 62677870
4-(4-ethoxyphenyl)-3-(2-methylbutan-2-yl)-1,2-oxazol-5-amine (PubChem CID 62677870) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-3-(2-methylbutan-2-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(4-ethoxyphenyl)-3-(2-methylbutan-2-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 62677870 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-(4-ethoxyphenyl)-3-(2-methylbutan-2-yl)-1,2-oxazol-5-amine |
| SMILES | CCOc1ccc(-c2c(C(C)(C)CC)noc2N)cc1 |
| InChI | InChI=1S/C16H22N2O2/c1-5-16(3,4)14-13(15(17)20-18-14)11-7-9-12(10-8-11)19-6-2/h7-10H,5-6,17H2,1-4H3 |
| InChIKey | GTYKJKQIDODOOF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |